| CAS Number | 196212-27-8 |
| Product Code | SL1211006 |
| EC Number | 691-533-3 |
| Molecular Formula | C18H28B2O4 |
| Molecular Weight | 330.0 |
| Appearance | White powder |
| Melting Point | 133.0 to 137.0 °C |
| Boiling Point | 430.9±28.0 °C (Predicted) |
| Density | 1.03±0.1 g/cm³ (Predicted) |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| Description | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| Applications | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |