| Номер CAS | 196212-27-8 |
|---|
| Номер EC/List | 691-533-3 |
|---|
| Молекулярная формула | C18H28B2O4 |
|---|
| Молекулярная масса | 330.00 g/mol |
|---|
| Внешний вид | White powder |
|---|
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
|---|
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
|---|
| Описание | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
|---|
| Применение | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
|---|
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
