| Número CAS | 196212-27-8 |
| N.º CE/lista | 691-533-3 |
| Fórmula molecular | C18H28B2O4 |
| Masa molar | 330.00 g/mol |
| Aspecto | White powder |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| Descripción | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| Aplicaciones | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
| Clase de peligro | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |