| Numéro CAS | 196212-27-8 |
| Code produit | SL1211006 |
| Numéro CE | 691-533-3 |
| Formule moléculaire | C18H28B2O4 |
| Masse molaire | 330.000000 |
| Aspect | White powder |
| Point de fusion | 133.0 to 137.0 °C |
| Point d'ébullition | 430.9±28.0 °C (Predicted) |
| Densité | 1.03±0.1 g/cm³ (Predicted) |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| Description | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| Applications | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |