| CAS-Nummer | 196212-27-8 |
| Produktcode | SL1211006 |
| EG-Nummer | 691-533-3 |
| Summenformel | C18H28B2O4 |
| Molare Masse | 330.0 |
| Aussehen | White powder |
| Schmelzpunkt | 133.0 to 137.0 °C |
| Siedepunkt | 430.9±28.0 °C (Predicted) |
| Dichte | 1.03±0.1 g/cm³ (Predicted) |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| Beschreibung | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| Anwendungen | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |