구조 특성
반응 특성
합성 역할
응용 맥락
| CAS 번호 | 196212-27-8 |
|---|---|
| 제품 코드 | SL1211006 |
| EC 번호 | 691-533-3 |
| 분자식 | C18H28B2O4 |
| 분자량 | 330.0 |
| 외관 | White powder |
| 녹는점 | 133.0 to 137.0 °C |
| 끓는점 | 430.9±28.0 °C (Predicted) |
| 밀도 | 1.03±0.1 g/cm³ (Predicted) |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| 제품 설명 | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| 용도 | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
