| CAS 번호 | 196212-27-8 |
| EC/List 번호 | 691-533-3 |
| 분자식 | C18H28B2O4 |
| 분자량 | 330.00 g/mol |
| 외관 | White powder |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| 제품 설명 | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| 용도 | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |