| CAS Number | 791-31-1 |
|---|---|
| Product Code | SL1113027 |
| EC Number | 212-339-3 |
| Molecular Formula | C18H16OSi |
| Molecular Weight | 276.4 |
| Melting Point | 150-153 °C (lit.) |
| Boiling Point | 389 °C (760 mmHg) |
| Density | 1.13 g/cm³ |
| Refractive Index | 1.628 |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| Description | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| Applications | Pharmaceutical intermediate; organosilicon; synthetic reagent |