| CAS-Nummer | 791-31-1 |
|---|---|
| Produktcode | SL1113027 |
| EG-Nummer | 212-339-3 |
| Summenformel | C18H16OSi |
| Molare Masse | 276.400000 |
| Schmelzpunkt | 150-153 °C (lit.) |
| Siedepunkt | 389 °C (760 mmHg) |
| Dichte | 1.13 g/cm³ |
| Brechungsindex | 1.628 |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| Beschreibung | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| Anwendungen | Pharmaceutical intermediate; organosilicon; synthetic reagent |