| CAS 번호 | 791-31-1 |
|---|---|
| 제품 코드 | SL1113027 |
| EC 번호 | 212-339-3 |
| 분자식 | C18H16OSi |
| 분자량 | 276.400000 |
| 녹는점 | 150-153 °C (lit.) |
| 끓는점 | 389 °C (760 mmHg) |
| 밀도 | 1.13 g/cm³ |
| 굴절률 | 1.628 |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| 제품 설명 | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| 용도 | Pharmaceutical intermediate; organosilicon; synthetic reagent |