| CAS 번호 | 791-31-1 |
|---|---|
| EC/List 번호 | 212-339-3 |
| 분자식 | C18H16OSi |
| 분자량 | 276.40 g/mol |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| 제품 설명 | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| 용도 | Pharmaceutical intermediate; organosilicon; synthetic reagent |
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |