Caractéristique structurelle
Caractéristique réactive
Rôle de synthèse
Contexte d'application
| Numéro CAS | 791-31-1 |
|---|---|
| Code produit | SL1113027 |
| Numéro CE | 212-339-3 |
| Formule moléculaire | C18H16OSi |
| Masse molaire | 276.4 |
| Point de fusion | 150-153 °C (lit.) |
| Point d'ébullition | 389 °C (760 mmHg) |
| Densité | 1.13 g/cm³ |
| Indice de réfraction | 1.628 |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| Description | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| Applications | Pharmaceutical intermediate; organosilicon; synthetic reagent |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
