| Номер CAS | 791-31-1 |
|---|---|
| Номер EC/List | 212-339-3 |
| Молекулярная формула | C18H16OSi |
| Молекулярная масса | 276.40 g/mol |
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
| Описание | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
| Применение | Pharmaceutical intermediate; organosilicon; synthetic reagent |
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |