| CAS-Nummer | 1403766-90-4 |
| Produktcode | SL1112001 |
| Summenformel | C9H13FO4 |
| Molare Masse | 204.2 |
| Aussehen | Colourless liquid |
| Siedepunkt | 293.7±40.0 °C (Predicted) |
| Dichte | 1.24±0.1 g/cm³ (Predicted) |
| SMILES | CC(C)OC(=O)C1(C(=O)O)CC(F)C1 |
| InChIKey | MAEAPDROKKEFAQ-UHFFFAOYSA-N |
| Beschreibung | Fluorinated cyclobutane dicarboxylate building block with isopropyl ester and free acid for selective deprotection. The fluorine modulates metabolic stability for drug-like cyclobutane scaffolds. |
| Anwendungen | Pharmaceutical intermediate; fluorinated building block; cyclobutane scaffold construction |