| Número CAS | 1403766-90-4 |
| Código de producto | SL1112001 |
| Fórmula molecular | C9H13FO4 |
| Masa molar | 204.200000 |
| Aspecto | Colourless liquid |
| Punto de ebullición | 293.7±40.0 °C (Predicted) |
| Densidad | 1.24±0.1 g/cm³ (Predicted) |
| SMILES | CC(C)OC(=O)C1(C(=O)O)CC(F)C1 |
| InChIKey | MAEAPDROKKEFAQ-UHFFFAOYSA-N |
| Descripción | Fluorinated cyclobutane dicarboxylate building block with isopropyl ester and free acid for selective deprotection. The fluorine modulates metabolic stability for drug-like cyclobutane scaffolds. |
| Aplicaciones | Pharmaceutical intermediate; fluorinated building block; cyclobutane scaffold construction |