| Номер CAS | 1403766-90-4 |
| Код продукта | SL1112001 |
| Молекулярная формула | C9H13FO4 |
| Молекулярная масса | 204.2 |
| Внешний вид | Colourless liquid |
| Температура кипения | 293.7±40.0 °C (Predicted) |
| Плотность | 1.24±0.1 g/cm³ (Predicted) |
| SMILES | CC(C)OC(=O)C1(C(=O)O)CC(F)C1 |
| InChIKey | MAEAPDROKKEFAQ-UHFFFAOYSA-N |
| Описание | Fluorinated cyclobutane dicarboxylate building block with isopropyl ester and free acid for selective deprotection. The fluorine modulates metabolic stability for drug-like cyclobutane scaffolds. |
| Применение | Pharmaceutical intermediate; fluorinated building block; cyclobutane scaffold construction |