| Номер CAS | 74863-84-6 |
| Код продукта | SL1113016 |
| Молекулярная формула | C23H36N6O5S |
| Молекулярная масса | 508.6 |
| Внешний вид | White to off-white crystalline powder |
| Температура плавления | 188-189 °C |
| Температура кипения | 777.2±70.0 °C (Predicted) |
| Плотность | 1.47±0.1 g/cm³ (Predicted) |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)C2=CC=CC3=C2NCC(C3)C |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| Описание | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| Применение | API; anticoagulant; thrombin inhibitor |