| CAS 번호 | 74863-84-6 |
|---|---|
| 제품 코드 | SL1113016 |
| 분자식 | C23H36N6O5S |
| 분자량 | 508.6 |
| 외관 | White to off-white crystalline powder |
| 녹는점 | 188-189 °C |
| 끓는점 | 777.2±70.0 °C (Predicted) |
| 밀도 | 1.47±0.1 g/cm³ (Predicted) |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)C2=CC=CC3=C2NCC(C3)C |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| 제품 설명 | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| 용도 | API; anticoagulant; thrombin inhibitor |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
