| Número CAS | 74863-84-6 |
| Código de producto | SL1113016 |
| Fórmula molecular | C23H36N6O5S |
| Masa molar | 508.600000 |
| Aspecto | White to off-white crystalline powder |
| Punto de fusión | 188-189 °C |
| Punto de ebullición | 777.2±70.0 °C (Predicted) |
| Densidad | 1.47±0.1 g/cm³ (Predicted) |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)C2=CC=CC3=C2NCC(C3)C |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| Descripción | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| Aplicaciones | API; anticoagulant; thrombin inhibitor |