| CAS Number | 69-89-6 |
|---|---|
| Product Code | SL1112037 |
| EC Number | 200-718-6 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 |
| Melting Point | >300 °C (dec.) |
| Boiling Point | Sublimes (dec.) |
| Density | 1.55 g/cm³ (Predicted) |
| Refractive Index | 1.8500 (estimate) |
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| Description | Xanthine (3,7-dihydropurine-2,6-dione), the purine alkaloid parent core. The parent compound of caffeine, theophylline, and theobromine; an important bioactive scaffold. |
| Applications | Pharmaceutical intermediate; purine scaffold; alkaloid |