| CAS 번호 | 69-89-6 |
|---|---|
| 제품 코드 | SL1112037 |
| EC 번호 | 200-718-6 |
| 분자식 | C5H4N4O2 |
| 분자량 | 152.11 |
| 녹는점 | >300 °C (dec.) |
| 끓는점 | Sublimes (dec.) |
| 밀도 | 1.55 g/cm³ (Predicted) |
| 굴절률 | 1.8500 (estimate) |
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| 제품 설명 | Xanthine (3,7-dihydropurine-2,6-dione), the purine alkaloid parent core. The parent compound of caffeine, theophylline, and theobromine; an important bioactive scaffold. |
| 용도 | Pharmaceutical intermediate; purine scaffold; alkaloid |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
