| Número CAS | 69-89-6 |
|---|---|
| Código de producto | SL1112037 |
| Número CE | 200-718-6 |
| Fórmula molecular | C5H4N4O2 |
| Masa molar | 152.11 |
| Punto de fusión | >300 °C (dec.) |
| Punto de ebullición | Sublimes (dec.) |
| Densidad | 1.55 g/cm³ (Predicted) |
| Índice de refracción | 1.8500 (estimate) |
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| Descripción | Xanthine (3,7-dihydropurine-2,6-dione), the purine alkaloid parent core. The parent compound of caffeine, theophylline, and theobromine; an important bioactive scaffold. |
| Aplicaciones | Pharmaceutical intermediate; purine scaffold; alkaloid |