| CAS Number | 288071-87-4 |
| Product Code | SL1213001 |
| EC Number | 683-683-3 |
| Molecular Formula | C14H6Br2N2S3 |
| Molecular Weight | 458.2 |
| Melting Point | 245-249 °C |
| Boiling Point | 527.3±45.0 °C (Predicted) |
| Density | 1.898 g/cm³ (Predicted) |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)s3)c3nsnc23)s1 |
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
| Description | 4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole, a benzothiadiazole with two bromothienyl groups. Important monomer for narrow-bandgap polymer solar cells and OLED materials. |
| Applications | OLED intermediate; polymer solar cell; Stille coupling substrate |