| CAS 번호 | 288071-87-4 |
|---|---|
| 제품 코드 | SL1213001 |
| EC 번호 | 683-683-3 |
| 분자식 | C14H6Br2N2S3 |
| 분자량 | 458.2 |
| 녹는점 | 245-249 °C |
| 끓는점 | 527.3±45.0 °C (Predicted) |
| 밀도 | 1.898 g/cm³ (Predicted) |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)s3)c3nsnc23)s1 |
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
| 제품 설명 | 4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole, a benzothiadiazole with two bromothienyl groups. Important monomer for narrow-bandgap polymer solar cells and OLED materials. |
| 용도 | OLED intermediate; polymer solar cell; Stille coupling substrate |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
