| CAS 번호 | 288071-87-4 |
|---|---|
| EC/List 번호 | 683-683-3 |
| 분자식 | C14H6Br2N2S3 |
| 분자량 | 458.20 g/mol |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)s3)c3nsnc23)s1 |
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
| 제품 설명 | 4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole, a benzothiadiazole with two bromothienyl groups. Important monomer for narrow-bandgap polymer solar cells and OLED materials. |
| 용도 | OLED intermediate; polymer solar cell; Stille coupling substrate |
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |