| CAS Number | 1158758-79-2 |
| EC/List No. | 894-091-1 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Appearance | Light yellow liquid |
| SMILES | CCC1(N)CN(C(=O)OC(C)(C)C)C1 |
| InChIKey | JPYCVKPRVHXSNZ-UHFFFAOYSA-N |
| Description | tert-Butyl 3-amino-3-ethylazetidine-1-carboxylate, a Boc-protected 3-amino-3-ethylazetidine. The 3,3-disubstitution provides a quaternary center and scaffold rigidity. |
| Applications | Pharmaceutical intermediate; azetidine; Boc-protected |
| Hazard Class | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |