| Номер CAS | 1158758-79-2 |
|---|
| Номер EC/List | 894-091-1 |
|---|
| Молекулярная формула | C10H20N2O2 |
|---|
| Молекулярная масса | 200.28 g/mol |
|---|
| Внешний вид | Light yellow liquid |
|---|
| SMILES | CCC1(N)CN(C(=O)OC(C)(C)C)C1 |
|---|
| InChIKey | JPYCVKPRVHXSNZ-UHFFFAOYSA-N |
|---|
| Описание | tert-Butyl 3-amino-3-ethylazetidine-1-carboxylate, a Boc-protected 3-amino-3-ethylazetidine. The 3,3-disubstitution provides a quaternary center and scaffold rigidity. |
|---|
| Применение | Pharmaceutical intermediate; azetidine; Boc-protected |
|---|
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
