| CAS-Nummer | 1255309-13-7 |
|---|---|
| Summenformel | C18H20BNO2 |
| Molare Masse | 293.20 g/mol |
| Aussehen | Off-white to light yellow crystalline powder |
| SMILES | CC1(C)OB(c2cccc3[nH]c4ccccc4c23)OC1(C)C |
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
| Beschreibung | Carbazole-4-boronic acid pinacol ester, an N-unprotected carbazole boronate. The boronate is a Suzuki coupling handle; the carbazole NH allows further functionalization for hole transport materials. |
| Anwendungen | OLED hole transport material synthesis; Suzuki coupling substrate |