| CAS 번호 | 1255309-13-7 |
|---|
| 제품 코드 | SL1211007 |
|---|
| 분자식 | C18H20BNO2 |
|---|
| 분자량 | 293.2 |
|---|
| 외관 | Off-white to light yellow crystalline powder |
|---|
| 녹는점 | 177 °C |
|---|
| 끓는점 | 474.3±18.0 °C (Predicted) |
|---|
| 밀도 | 1.16±0.1 g/cm³ (Predicted) |
|---|
| SMILES | CC1(C)OB(c2cccc3[nH]c4ccccc4c23)OC1(C)C |
|---|
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
|---|
| 제품 설명 | Carbazole-4-boronic acid pinacol ester, an N-unprotected carbazole boronate. The boronate is a Suzuki coupling handle; the carbazole NH allows further functionalization for hole transport materials. |
|---|
| 용도 | OLED hole transport material synthesis; Suzuki coupling substrate |
|---|
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
