| Numéro CAS | 1255309-13-7 |
| Code produit | SL1211007 |
| Formule moléculaire | C18H20BNO2 |
| Masse molaire | 293.200000 |
| Aspect | Off-white to light yellow crystalline powder |
| Point de fusion | 177 °C |
| Point d'ébullition | 474.3±18.0 °C (Predicted) |
| Densité | 1.16±0.1 g/cm³ (Predicted) |
| SMILES | CC1(C)OB(c2cccc3[nH]c4ccccc4c23)OC1(C)C |
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
| Description | Carbazole-4-boronic acid pinacol ester, an N-unprotected carbazole boronate. The boronate is a Suzuki coupling handle; the carbazole NH allows further functionalization for hole transport materials. |
| Applications | OLED hole transport material synthesis; Suzuki coupling substrate |