1,10-Phenanthroline, 2-phenyl-

1,10-Phenanthroline, 2-phenyl- structure
Номер CAS109559-47-9
Код продуктаSL1211009
Молекулярная формулаC18H12N2
Молекулярная масса256.3
Внешний видOff-white to yellow-brown solid
Температура плавления104 °C
Температура кипения468.9±30.0 °C (Predicted)
Плотность1.223±0.06 g/cm³ (Predicted)
SMILESc1ccc(-c2ccc3ccc4cccnc4c3n2)cc1
InChIKeyIYKBMPHOPLFHAQ-UHFFFAOYSA-N
Описание2-Phenyl-1,10-phenanthroline, a classic tridentate nitrogen ligand. The phenanthroline core offers strong coordination and electron transport properties for OLEDs and metal complex catalysis.
ПрименениеOLED electron transport material; metal ligand

Родственные соединения