1,10-Phenanthroline, 2-phenyl-

Demander ce produit Synthèse sur commande d’un analogue
1,10-Phenanthroline, 2-phenyl- structure
Structural Feature
Nitrogen heteroarene Phenanthroline scaffold
Reactive Feature
Coordinating nitrogen sites
Synthesis Role
Ligand intermediate
Application Context
OLED material intermediate Optoelectronic materials
Numéro CAS109559-47-9
Formule moléculaireC18H12N2
Masse molaire256.30 g/mol
AspectOff-white to yellow-brown solid
SMILESc1ccc(-c2ccc3ccc4cccnc4c3n2)cc1
InChIKeyIYKBMPHOPLFHAQ-UHFFFAOYSA-N
Description2-Phenyl-1,10-phenanthroline, a classic tridentate nitrogen ligand. The phenanthroline core offers strong coordination and electron transport properties for OLEDs and metal complex catalysis.
ApplicationsOLED electron transport material; metal ligand