1,10-Phenanthroline, 2-phenyl-

이 제품 문의하기 유사체 맞춤 합성
1,10-Phenanthroline, 2-phenyl- structure
Structural Feature
Nitrogen heteroarene Phenanthroline scaffold
Reactive Feature
Coordinating nitrogen sites
Synthesis Role
Ligand intermediate
Application Context
OLED material intermediate Optoelectronic materials
CAS 번호109559-47-9
분자식C18H12N2
분자량256.30 g/mol
외관Off-white to yellow-brown solid
SMILESc1ccc(-c2ccc3ccc4cccnc4c3n2)cc1
InChIKeyIYKBMPHOPLFHAQ-UHFFFAOYSA-N
제품 설명2-Phenyl-1,10-phenanthroline, a classic tridentate nitrogen ligand. The phenanthroline core offers strong coordination and electron transport properties for OLEDs and metal complex catalysis.
용도OLED electron transport material; metal ligand