3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide

3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide structure
Structural Feature
Reactive Feature
Номер CAS85622-93-1
Молекулярная формулаC6H6N6O2
Молекулярная масса194.15 g/mol
Внешний видWhite to off-white solid
SMILESCn1nnc2c(C(N)=O)ncn2c1=O
InChIKeyBPEGJWRSRHCHSN-UHFFFAOYSA-N
ОписаниеTemozolomide, an imidazotetrazine antineoplastic agent. Spontaneously degrades at physiological pH to generate a methyldiazonium ion that methylates DNA O6-guanine; used for glioblastoma.
ПрименениеAPI; antineoplastic; alkylating agent
Класс опасностиCarc. 1B; Muta. 1B; Repr. 1B; STOT RE 1; Eye Irrit. 2; STOT SE 3; Skin Irrit. 2