| CAS 번호 | 115144-35-9 |
|---|---|
| 제품 코드 | SL1113019 |
| 분자식 | C11H7KN2O3S2 |
| 분자량 | 318.400000 |
| 외관 | Light yellow to brown powder |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[K+] |
| InChIKey | UMBKGTQQGYPQBE-OGFXRTJISA-M |
| 제품 설명 | D-Luciferin potassium salt, the potassium salt form of the firefly luciferase substrate. Same application as sodium salt; potassium salt may offer better solubility in some cell-based assays. |
| 용도 | Bio-reagent; luciferase substrate; in vivo imaging |