| Numéro CAS | 115144-35-9 |
|---|---|
| Code produit | SL1113019 |
| Formule moléculaire | C11H7KN2O3S2 |
| Masse molaire | 318.4 |
| Aspect | Light yellow to brown powder |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[K+] |
| InChIKey | UMBKGTQQGYPQBE-OGFXRTJISA-M |
| Description | D-Luciferin potassium salt, the potassium salt form of the firefly luciferase substrate. Same application as sodium salt; potassium salt may offer better solubility in some cell-based assays. |
| Applications | Bio-reagent; luciferase substrate; in vivo imaging |