Fórmula estructural
| Número CAS | 115144-35-9 |
|---|---|
| Fórmula molecular | C11H7KN2O3S2 |
| Masa molar | 318.40 g/mol |
| Aspecto | Light yellow to brown powder |
| SMILES | O=C([O-])[C@H]1CSC(c2nc3ccc(O)cc3s2)=N1.[K+] |
| InChIKey | UMBKGTQQGYPQBE-OGFXRTJISA-M |
| Descripción | D-Luciferin potassium salt, the potassium salt form of the firefly luciferase substrate. Same application as sodium salt; potassium salt may offer better solubility in some cell-based assays. |
| Aplicaciones | Bio-reagent; luciferase substrate; in vivo imaging |