| Numéro CAS | 619-14-7 |
|---|---|
| Formule moléculaire | C7H5NO5 |
| Masse molaire | 183.12 g/mol |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Description | 3-Hydroxy-4-nitrobenzoic acid, a disubstituted benzoic acid with hydroxyl and nitro. The nitro can be reduced to amine for aminohydroxybenzoic acid intermediates. |
| Applications | Pharmaceutical intermediate; benzoic acid; nitrophenol |
| Classe de danger | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |