| Número CAS | 619-14-7 |
|---|---|
| Código de producto | SL1113028 |
| Fórmula molecular | C7H5NO5 |
| Masa molar | 183.12 |
| Punto de fusión | 229-231 °C (lit.) |
| Índice de refracción | 1.6280 (estimate) |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Descripción | 3-Hydroxy-4-nitrobenzoic acid, a disubstituted benzoic acid with hydroxyl and nitro. The nitro can be reduced to amine for aminohydroxybenzoic acid intermediates. |
| Aplicaciones | Pharmaceutical intermediate; benzoic acid; nitrophenol |