| CAS 번호 | 2253847-57-1 |
|---|---|
| 제품 코드 | SL1211014 |
| 분자식 | C18H12N2O2 |
| 분자량 | 288.300000 |
| 외관 | Yellow to yellow-green solid |
| 끓는점 | 529.4±25.0 °C (Predicted) |
| 밀도 | 1.352±0.06 g/cm³ (Predicted) |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2[nH]c3ccccc3c12 |
| InChIKey | KIGLUVGGXJPXKC-UHFFFAOYSA-N |
| 제품 설명 | 4-(2-Nitrophenyl)-9H-carbazole, an ortho-nitro substituted carbazole. The nitro group can be reduced to amine for constructing carbazole-arylamine OLED hole transport materials. |
| 용도 | OLED hole transport material synthesis; carbazole functionalization |