| Número CAS | 2253847-57-1 |
| Código de producto | SL1211014 |
| Fórmula molecular | C18H12N2O2 |
| Masa molar | 288.3 |
| Aspecto | Yellow to yellow-green solid |
| Punto de ebullición | 529.4±25.0 °C (Predicted) |
| Densidad | 1.352±0.06 g/cm³ (Predicted) |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2[nH]c3ccccc3c12 |
| InChIKey | KIGLUVGGXJPXKC-UHFFFAOYSA-N |
| Descripción | 4-(2-Nitrophenyl)-9H-carbazole, an ortho-nitro substituted carbazole. The nitro group can be reduced to amine for constructing carbazole-arylamine OLED hole transport materials. |
| Aplicaciones | OLED hole transport material synthesis; carbazole functionalization |