| CAS 번호 | 103404-75-7 |
|---|---|
| 제품 코드 | SL1113018 |
| EC 번호 | 600-430-4 |
| 분자식 | C11H7N2NaO3S2 |
| 분자량 | 302.3 |
| 외관 | Light yellow to brown powder |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[Na+] |
| InChIKey | LILQLBIQROYWIA-OGFXRTJISA-M |
| 제품 설명 | D-Luciferin sodium salt, a firefly luciferase substrate. Enzymatically oxidized in the presence of ATP and oxygen to emit light; widely used for ATP bioluminescence assays and in vivo imaging. |
| 용도 | Bio-reagent; luciferase substrate; in vivo imaging |
![2,4-Dichloro-7H-pyrrolo[2,3-d]pyriMidine structure](/static/structures/63fd87c606a252dbb3ef18c3.svg)
