Formule développée
| Numéro CAS | 103404-75-7 |
|---|---|
| N° CE / liste | 600-430-4 |
| Formule moléculaire | C11H7N2NaO3S2 |
| Masse molaire | 302.30 g/mol |
| Aspect | Light yellow to brown powder |
| SMILES | O=C([O-])[C@H]1CSC(c2nc3ccc(O)cc3s2)=N1.[Na+] |
| InChIKey | LILQLBIQROYWIA-OGFXRTJISA-M |
| Description | D-Luciferin sodium salt, a firefly luciferase substrate. Enzymatically oxidized in the presence of ATP and oxygen to emit light; widely used for ATP bioluminescence assays and in vivo imaging. |
| Applications | Bio-reagent; luciferase substrate; in vivo imaging |