| Formule moléculaire | C8H8 |
|---|---|
| Masse molaire | 104.15 g/mol |
| SMILES | c1ccc2c(c1)CC2 |
| InChIKey | UMIVXZPTRXBADB-UHFFFAOYSA-N |
| Synonymes | BICYCLO[4.2.0]OCTA-1,3,5-TRIENE;Bicyclo[4.2.0]octa-1(6),2,4-triene;Cardene;Benzocyclobutene (BCB);1,2-dihydrocyclobutabenzene;BENZOCYCLOBUTENE;Benzocyclobutane;1,2-Ethenobenzene;Benzocyclobutadiene;2,3-Vinylenebenzene |
|---|---|
| Nom IUPAC | bicyclo[4.2.0]octa-1,3,5-triene |
| N° CE / liste | 633-274-0 |
| Masse exacte | 104.062600 |
| Masse monoisotopique | 104.062600 |
| XLogP | 1.800000 |
| TPSA | 0.000000 Ų |
| Donneurs / accepteurs de liaison H | 0 / 0 |
| Liaisons rotatives | 0 |
| InChI | InChI=1S/C8H8/c1-2-4-8-6-5-7(8)3-1/h1-4H,5-6H2 |
Benzocyclobutene is a carbobicyclic compound that is benzene fused to a cyclobutane ring. It has a role as a metabolite.